About [4-[4-[(1S,2S)-2-(propan-2-ylsulfonylamino)cyclopentyl]phenyl]phenyl] hydrogen carbonate
[4-[4-[(1S,2S)-2-(propan-2-ylsulfonylamino)cyclopentyl]phenyl]phenyl] hydrogen carbonate (PubChem CID 69112761) has the molecular formula C21H25NO5S
and a molecular weight of 403.50 g/mol. Its IUPAC name is [4-[4-[(1S,2S)-2-(propan-2-ylsulfonylamino)cyclopentyl]phenyl]phenyl] hydrogen carbonate.
Molecular Properties
| Compound Name | [4-[4-[(1S,2S)-2-(propan-2-ylsulfonylamino)cyclopentyl]phenyl]phenyl] hydrogen carbonate |
| PubChem CID | 69112761 |
| Molecular Formula | C21H25NO5S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | [4-[4-[(1S,2S)-2-(propan-2-ylsulfonylamino)cyclopentyl]phenyl]phenyl] hydrogen carbonate |
| SMILES | CC(C)S(=O)(=O)N[C@H]1CCC[C@H]1c1ccc(-c2ccc(OC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C21H25NO5S/c1-14(2)28(25,26)22-20-5-3-4-19(20)17-8-6-15(7-9-17)16-10-12-18(13-11-16)27-21(23)24/h6-14,19-20,22H,3-5H2,1-2H3,(H,23,24)/t19-,20-/m0/s1 |
| InChIKey | YKIVTNWMUPCZMN-PMACEKPBSA-N |
| XLogP | 4.37 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [4-[4-[(1S,2S)-2-(propan-2-ylsulfonylamino)cyclopentyl]phenyl]phenyl] hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-[(1S,2S)-2-(propan-2-ylsulfonylamino)cyclopentyl]phenyl]phenyl] hydrogen carbonate?
The IUPAC name of [4-[4-[(1S,2S)-2-(propan-2-ylsulfonylamino)cyclopentyl]phenyl]phenyl] hydrogen carbonate (CID 69112761) is [4-[4-[(1S,2S)-2-(propan-2-ylsulfonylamino)cyclopentyl]phenyl]phenyl] hydrogen carbonate.
What is the SMILES notation for [4-[4-[(1S,2S)-2-(propan-2-ylsulfonylamino)cyclopentyl]phenyl]phenyl] hydrogen carbonate?
The canonical SMILES for [4-[4-[(1S,2S)-2-(propan-2-ylsulfonylamino)cyclopentyl]phenyl]phenyl] hydrogen carbonate is CC(C)S(=O)(=O)N[C@H]1CCC[C@H]1c1ccc(-c2ccc(OC(=O)O)cc2)cc1.
What is the InChIKey of [4-[4-[(1S,2S)-2-(propan-2-ylsulfonylamino)cyclopentyl]phenyl]phenyl] hydrogen carbonate?
The InChIKey is YKIVTNWMUPCZMN-PMACEKPBSA-N. The full InChI is InChI=1S/C21H25NO5S/c1-14(2)28(25,26)22-20-5-3-4-19(20)17-8-6-15(7-9-17)16-10-12-18(13-11-16)27-21(23)24/h6-14,19-20,22H,3-5H2,1-2H3,(H,23,24)/t19-,20-/m0/s1.
What are the key properties of [4-[4-[(1S,2S)-2-(propan-2-ylsulfonylamino)cyclopentyl]phenyl]phenyl] hydrogen carbonate?
[4-[4-[(1S,2S)-2-(propan-2-ylsulfonylamino)cyclopentyl]phenyl]phenyl] hydrogen carbonate has a molecular weight of 403.50 g/mol, XLogP of 4.37, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-[(1S,2S)-2-(propan-2-ylsulfonylamino)cyclopentyl]phenyl]phenyl] hydrogen carbonate is sourced from PubChem (CID 69112761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).