C25H28Cl2N4O — CID 69112869
N-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-2-(2-chlorophenyl)-3-(4-chlorophenyl)-4-ethyl-3,4-dihydropyrazole-5-carboxamide (PubChem CID 69112869) has the molecular formula C25H28Cl2N4O and a molecular weight of 471.43 g/mol. Its IUPAC name is N-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-2-(2-chlorophenyl)-3-(4-chlorophenyl)-4-ethyl-3,4-dihydropyrazole-5-carboxamide.
| Compound Name | N-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-2-(2-chlorophenyl)-3-(4-chlorophenyl)-4-ethyl-3,4-dihydropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 69112869 |
| Molecular Formula | C25H28Cl2N4O |
| Molecular Weight | 471.43 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | N-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-2-(2-chlorophenyl)-3-(4-chlorophenyl)-4-ethyl-3,4-dihydropyrazole-5-carboxamide |
| SMILES | CCC1C(C(=O)NN2CC3CCCC3C2)=NN(c2ccccc2Cl)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H28Cl2N4O/c1-2-20-23(25(32)29-30-14-17-6-5-7-18(17)15-30)28-31(22-9-4-3-8-21(22)27)24(20)16-10-12-19(26)13-11-16/h3-4,8-13,17-18,20,24H,2,5-7,14-15H2,1H3,(H,29,32) |
| InChIKey | BOFWABAYLFLXDR-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.43 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |