About 4-bromo-3-methoxy-N,5-dimethylthiophene-2-carboxamide
4-bromo-3-methoxy-N,5-dimethylthiophene-2-carboxamide (PubChem CID 69113007) has the molecular formula C8H10BrNO2S
and a molecular weight of 264.14 g/mol. Its IUPAC name is 4-bromo-3-methoxy-N,5-dimethylthiophene-2-carboxamide.
Molecular Properties
| Compound Name | 4-bromo-3-methoxy-N,5-dimethylthiophene-2-carboxamide |
| PubChem CID | 69113007 |
| Molecular Formula | C8H10BrNO2S |
| Molecular Weight | 264.14 g/mol |
| Exact Mass | 262.96 |
| IUPAC Name | 4-bromo-3-methoxy-N,5-dimethylthiophene-2-carboxamide |
| SMILES | CNC(=O)c1sc(C)c(Br)c1OC |
| InChI | InChI=1S/C8H10BrNO2S/c1-4-5(9)6(12-3)7(13-4)8(11)10-2/h1-3H3,(H,10,11) |
| InChIKey | POLRHXLHPKVYGW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.14 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-3-methoxy-N,5-dimethylthiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3-methoxy-N,5-dimethylthiophene-2-carboxamide?
The IUPAC name of 4-bromo-3-methoxy-N,5-dimethylthiophene-2-carboxamide (CID 69113007) is 4-bromo-3-methoxy-N,5-dimethylthiophene-2-carboxamide.
What is the SMILES notation for 4-bromo-3-methoxy-N,5-dimethylthiophene-2-carboxamide?
The canonical SMILES for 4-bromo-3-methoxy-N,5-dimethylthiophene-2-carboxamide is CNC(=O)c1sc(C)c(Br)c1OC.
What is the InChIKey of 4-bromo-3-methoxy-N,5-dimethylthiophene-2-carboxamide?
The InChIKey is POLRHXLHPKVYGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BrNO2S/c1-4-5(9)6(12-3)7(13-4)8(11)10-2/h1-3H3,(H,10,11).
What are the key properties of 4-bromo-3-methoxy-N,5-dimethylthiophene-2-carboxamide?
4-bromo-3-methoxy-N,5-dimethylthiophene-2-carboxamide has a molecular weight of 264.14 g/mol, XLogP of 2.19, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3-methoxy-N,5-dimethylthiophene-2-carboxamide is sourced from PubChem (CID 69113007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).