C17H18ClN5O4S — CID 69113073
tert-butyl 3-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-2-(hydrazinecarbonyl)imidazole-4-carboxylate (PubChem CID 69113073) has the molecular formula C17H18ClN5O4S and a molecular weight of 423.88 g/mol. Its IUPAC name is tert-butyl 3-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-2-(hydrazinecarbonyl)imidazole-4-carboxylate.
| Compound Name | tert-butyl 3-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-2-(hydrazinecarbonyl)imidazole-4-carboxylate |
|---|---|
| PubChem CID | 69113073 |
| Molecular Formula | C17H18ClN5O4S |
| Molecular Weight | 423.88 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | tert-butyl 3-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-2-(hydrazinecarbonyl)imidazole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1cnc(C(=O)NN)n1Cc1cc(-c2ccc(Cl)s2)on1 |
| InChI | InChI=1S/C17H18ClN5O4S/c1-17(2,3)26-16(25)10-7-20-14(15(24)21-19)23(10)8-9-6-11(27-22-9)12-4-5-13(18)28-12/h4-7H,8,19H2,1-3H3,(H,21,24) |
| InChIKey | VTUZOYXBVWDZPW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 125.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.88 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|