C25H45NO2 — CID 69113341
3,5-bis(2,6-dimethylhept-5-enyl)-7a-ethyl-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazole (PubChem CID 69113341) has the molecular formula C25H45NO2 and a molecular weight of 391.64 g/mol. Its IUPAC name is 3,5-bis(2,6-dimethylhept-5-enyl)-7a-ethyl-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazole.
| Compound Name | 3,5-bis(2,6-dimethylhept-5-enyl)-7a-ethyl-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazole |
|---|---|
| PubChem CID | 69113341 |
| Molecular Formula | C25H45NO2 |
| Molecular Weight | 391.64 g/mol |
| Exact Mass | 391.35 |
| IUPAC Name | 3,5-bis(2,6-dimethylhept-5-enyl)-7a-ethyl-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazole |
| SMILES | CCC12COC(CC(C)CCC=C(C)C)N1C(CC(C)CCC=C(C)C)OC2 |
| InChI | InChI=1S/C25H45NO2/c1-8-25-17-27-23(15-21(6)13-9-11-19(2)3)26(25)24(28-18-25)16-22(7)14-10-12-20(4)5/h11-12,21-24H,8-10,13-18H2,1-7H3 |
| InChIKey | GRYNLPKYENXLBZ-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.64 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|