C27H29NO3 — CID 69113674
(6aR,12aS)-12-benzyl-1,9-dimethoxy-7,7-dimethyl-6a,12a-dihydro-6H-chromeno[4,3-b]quinoline (PubChem CID 69113674) has the molecular formula C27H29NO3 and a molecular weight of 415.53 g/mol. Its IUPAC name is (6aR,12aS)-12-benzyl-1,9-dimethoxy-7,7-dimethyl-6a,12a-dihydro-6H-chromeno[4,3-b]quinoline.
| Compound Name | (6aR,12aS)-12-benzyl-1,9-dimethoxy-7,7-dimethyl-6a,12a-dihydro-6H-chromeno[4,3-b]quinoline |
|---|---|
| PubChem CID | 69113674 |
| Molecular Formula | C27H29NO3 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | (6aR,12aS)-12-benzyl-1,9-dimethoxy-7,7-dimethyl-6a,12a-dihydro-6H-chromeno[4,3-b]quinoline |
| SMILES | COc1ccc2c(c1)C(C)(C)[C@H]1COc3cccc(OC)c3[C@H]1N2Cc1ccccc1 |
| InChI | InChI=1S/C27H29NO3/c1-27(2)20-15-19(29-3)13-14-22(20)28(16-18-9-6-5-7-10-18)26-21(27)17-31-24-12-8-11-23(30-4)25(24)26/h5-15,21,26H,16-17H2,1-4H3/t21-,26-/m0/s1 |
| InChIKey | GNGJIPQCZHQTKQ-LVXARBLLSA-N |
| XLogP | 5.75 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|