About oxalic acid;pyrimidine-2,4-diamine
oxalic acid;pyrimidine-2,4-diamine (PubChem CID 69114148) has the molecular formula C6H8N4O4
and a molecular weight of 200.15 g/mol. Its IUPAC name is oxalic acid;pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | oxalic acid;pyrimidine-2,4-diamine |
| PubChem CID | 69114148 |
| Molecular Formula | C6H8N4O4 |
| Molecular Weight | 200.15 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | oxalic acid;pyrimidine-2,4-diamine |
| SMILES | Nc1ccnc(N)n1.O=C(O)C(=O)O |
| InChI | InChI=1S/C4H6N4.C2H2O4/c5-3-1-2-7-4(6)8-3;3-1(4)2(5)6/h1-2H,(H4,5,6,7,8);(H,3,4)(H,5,6) |
| InChIKey | WNNCPZVLNIRWNK-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 152.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.15 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze oxalic acid;pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxalic acid;pyrimidine-2,4-diamine?
The IUPAC name of oxalic acid;pyrimidine-2,4-diamine (CID 69114148) is oxalic acid;pyrimidine-2,4-diamine.
What is the SMILES notation for oxalic acid;pyrimidine-2,4-diamine?
The canonical SMILES for oxalic acid;pyrimidine-2,4-diamine is Nc1ccnc(N)n1.O=C(O)C(=O)O.
What is the InChIKey of oxalic acid;pyrimidine-2,4-diamine?
The InChIKey is WNNCPZVLNIRWNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N4.C2H2O4/c5-3-1-2-7-4(6)8-3;3-1(4)2(5)6/h1-2H,(H4,5,6,7,8);(H,3,4)(H,5,6).
What are the key properties of oxalic acid;pyrimidine-2,4-diamine?
oxalic acid;pyrimidine-2,4-diamine has a molecular weight of 200.15 g/mol, XLogP of -1.20, 0 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for oxalic acid;pyrimidine-2,4-diamine is sourced from PubChem (CID 69114148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).