About methyl 1-oxo-2,3-dihydroisoindole-5-carboxylate
methyl 1-oxo-2,3-dihydroisoindole-5-carboxylate (PubChem CID 69114316) has the molecular formula C10H9NO3
and a molecular weight of 191.19 g/mol. Its IUPAC name is methyl 1-oxo-2,3-dihydroisoindole-5-carboxylate.
Molecular Properties
| Compound Name | methyl 1-oxo-2,3-dihydroisoindole-5-carboxylate |
| PubChem CID | 69114316 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | methyl 1-oxo-2,3-dihydroisoindole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)CNC2=O |
| InChI | InChI=1S/C10H9NO3/c1-14-10(13)6-2-3-8-7(4-6)5-11-9(8)12/h2-4H,5H2,1H3,(H,11,12) |
| InChIKey | UPFFKPZXJRBTDT-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 1-oxo-2,3-dihydroisoindole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-oxo-2,3-dihydroisoindole-5-carboxylate?
The IUPAC name of methyl 1-oxo-2,3-dihydroisoindole-5-carboxylate (CID 69114316) is methyl 1-oxo-2,3-dihydroisoindole-5-carboxylate.
What is the SMILES notation for methyl 1-oxo-2,3-dihydroisoindole-5-carboxylate?
The canonical SMILES for methyl 1-oxo-2,3-dihydroisoindole-5-carboxylate is COC(=O)c1ccc2c(c1)CNC2=O.
What is the InChIKey of methyl 1-oxo-2,3-dihydroisoindole-5-carboxylate?
The InChIKey is UPFFKPZXJRBTDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO3/c1-14-10(13)6-2-3-8-7(4-6)5-11-9(8)12/h2-4H,5H2,1H3,(H,11,12).
What are the key properties of methyl 1-oxo-2,3-dihydroisoindole-5-carboxylate?
methyl 1-oxo-2,3-dihydroisoindole-5-carboxylate has a molecular weight of 191.19 g/mol, XLogP of 0.72, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-oxo-2,3-dihydroisoindole-5-carboxylate is sourced from PubChem (CID 69114316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).