C20H18Cl2FN3O2 — CID 69114390
1-(2,4-dichlorophenyl)-5-[4-(3-fluoropropoxy)phenyl]-4-methylpyrazole-3-carboxamide (PubChem CID 69114390) has the molecular formula C20H18Cl2FN3O2 and a molecular weight of 422.29 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-5-[4-(3-fluoropropoxy)phenyl]-4-methylpyrazole-3-carboxamide.
| Compound Name | 1-(2,4-dichlorophenyl)-5-[4-(3-fluoropropoxy)phenyl]-4-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 69114390 |
| Molecular Formula | C20H18Cl2FN3O2 |
| Molecular Weight | 422.29 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-5-[4-(3-fluoropropoxy)phenyl]-4-methylpyrazole-3-carboxamide |
| SMILES | Cc1c(C(N)=O)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(OCCCF)cc1 |
| InChI | InChI=1S/C20H18Cl2FN3O2/c1-12-18(20(24)27)25-26(17-8-5-14(21)11-16(17)22)19(12)13-3-6-15(7-4-13)28-10-2-9-23/h3-8,11H,2,9-10H2,1H3,(H2,24,27) |
| InChIKey | NEQYGFOUIAECAU-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.29 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|