C31H32F3N5O5 — CID 69114450
[1-[(1-aminoisoquinolin-6-yl)amino]-2-[(3-aminophenyl)methylamino]-1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-oxoethyl] 2,2,2-trifluoroacetate (PubChem CID 69114450) has the molecular formula C31H32F3N5O5 and a molecular weight of 611.62 g/mol. Its IUPAC name is [1-[(1-aminoisoquinolin-6-yl)amino]-2-[(3-aminophenyl)methylamino]-1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-oxoethyl] 2,2,2-trifluoroacetate.
| Compound Name | [1-[(1-aminoisoquinolin-6-yl)amino]-2-[(3-aminophenyl)methylamino]-1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-oxoethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 69114450 |
| Molecular Formula | C31H32F3N5O5 |
| Molecular Weight | 611.62 g/mol |
| Exact Mass | 611.24 |
| IUPAC Name | [1-[(1-aminoisoquinolin-6-yl)amino]-2-[(3-aminophenyl)methylamino]-1-(3-ethoxy-4-propan-2-yloxyphenyl)-2-oxoethyl] 2,2,2-trifluoroacetate |
| SMILES | CCOc1cc(C(Nc2ccc3c(N)nccc3c2)(OC(=O)C(F)(F)F)C(=O)NCc2cccc(N)c2)ccc1OC(C)C |
| InChI | InChI=1S/C31H32F3N5O5/c1-4-42-26-16-21(8-11-25(26)43-18(2)3)30(44-29(41)31(32,33)34,28(40)38-17-19-6-5-7-22(35)14-19)39-23-9-10-24-20(15-23)12-13-37-27(24)36/h5-16,18,39H,4,17,35H2,1-3H3,(H2,36,37)(H,38,40) |
| InChIKey | RMYDREZPGVBQQF-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 150.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.62 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|