C17H18N2O5 — CID 6911462
3-hydroxy-N-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]benzamide (PubChem CID 6911462) has the molecular formula C17H18N2O5 and a molecular weight of 330.34 g/mol. Its IUPAC name is 3-hydroxy-N-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]benzamide.
| Compound Name | 3-hydroxy-N-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 6911462 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 3-hydroxy-N-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1cc(OC)c(OC)cc1/C=N/NC(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C17H18N2O5/c1-22-14-9-16(24-3)15(23-2)8-12(14)10-18-19-17(21)11-5-4-6-13(20)7-11/h4-10,20H,1-3H3,(H,19,21)/b18-10+ |
| InChIKey | BABOFVFQKKAKCO-VCHYOVAHSA-N |
| XLogP | 2.18 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|