About 3-(1-benzothiophen-2-yl)-1,4,2-oxathiazine
3-(1-benzothiophen-2-yl)-1,4,2-oxathiazine (PubChem CID 69114948) has the molecular formula C11H7NOS2
and a molecular weight of 233.32 g/mol. Its IUPAC name is 3-(1-benzothiophen-2-yl)-1,4,2-oxathiazine.
Molecular Properties
| Compound Name | 3-(1-benzothiophen-2-yl)-1,4,2-oxathiazine |
| PubChem CID | 69114948 |
| Molecular Formula | C11H7NOS2 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.00 |
| IUPAC Name | 3-(1-benzothiophen-2-yl)-1,4,2-oxathiazine |
| SMILES | C1=CSC(c2cc3ccccc3s2)=NO1 |
| InChI | InChI=1S/C11H7NOS2/c1-2-4-9-8(3-1)7-10(15-9)11-12-13-5-6-14-11/h1-7H |
| InChIKey | VQIDCYSIXDVRGL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1-benzothiophen-2-yl)-1,4,2-oxathiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-benzothiophen-2-yl)-1,4,2-oxathiazine?
The IUPAC name of 3-(1-benzothiophen-2-yl)-1,4,2-oxathiazine (CID 69114948) is 3-(1-benzothiophen-2-yl)-1,4,2-oxathiazine.
What is the SMILES notation for 3-(1-benzothiophen-2-yl)-1,4,2-oxathiazine?
The canonical SMILES for 3-(1-benzothiophen-2-yl)-1,4,2-oxathiazine is C1=CSC(c2cc3ccccc3s2)=NO1.
What is the InChIKey of 3-(1-benzothiophen-2-yl)-1,4,2-oxathiazine?
The InChIKey is VQIDCYSIXDVRGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7NOS2/c1-2-4-9-8(3-1)7-10(15-9)11-12-13-5-6-14-11/h1-7H.
What are the key properties of 3-(1-benzothiophen-2-yl)-1,4,2-oxathiazine?
3-(1-benzothiophen-2-yl)-1,4,2-oxathiazine has a molecular weight of 233.32 g/mol, XLogP of 3.80, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-benzothiophen-2-yl)-1,4,2-oxathiazine is sourced from PubChem (CID 69114948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).