About 5-(5-bromo-1,3-thiazol-2-yl)pentan-1-amine
5-(5-bromo-1,3-thiazol-2-yl)pentan-1-amine (PubChem CID 69115311) has the molecular formula C8H13BrN2S
and a molecular weight of 249.18 g/mol. Its IUPAC name is 5-(5-bromo-1,3-thiazol-2-yl)pentan-1-amine.
Molecular Properties
| Compound Name | 5-(5-bromo-1,3-thiazol-2-yl)pentan-1-amine |
| PubChem CID | 69115311 |
| Molecular Formula | C8H13BrN2S |
| Molecular Weight | 249.18 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 5-(5-bromo-1,3-thiazol-2-yl)pentan-1-amine |
| SMILES | NCCCCCc1ncc(Br)s1 |
| InChI | InChI=1S/C8H13BrN2S/c9-7-6-11-8(12-7)4-2-1-3-5-10/h6H,1-5,10H2 |
| InChIKey | AHSVRNSCIMXQFG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.18 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(5-bromo-1,3-thiazol-2-yl)pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-bromo-1,3-thiazol-2-yl)pentan-1-amine?
The IUPAC name of 5-(5-bromo-1,3-thiazol-2-yl)pentan-1-amine (CID 69115311) is 5-(5-bromo-1,3-thiazol-2-yl)pentan-1-amine.
What is the SMILES notation for 5-(5-bromo-1,3-thiazol-2-yl)pentan-1-amine?
The canonical SMILES for 5-(5-bromo-1,3-thiazol-2-yl)pentan-1-amine is NCCCCCc1ncc(Br)s1.
What is the InChIKey of 5-(5-bromo-1,3-thiazol-2-yl)pentan-1-amine?
The InChIKey is AHSVRNSCIMXQFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13BrN2S/c9-7-6-11-8(12-7)4-2-1-3-5-10/h6H,1-5,10H2.
What are the key properties of 5-(5-bromo-1,3-thiazol-2-yl)pentan-1-amine?
5-(5-bromo-1,3-thiazol-2-yl)pentan-1-amine has a molecular weight of 249.18 g/mol, XLogP of 2.58, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-bromo-1,3-thiazol-2-yl)pentan-1-amine is sourced from PubChem (CID 69115311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).