C14H21FO7S — CID 69115622
[(2R,3R,4S,5R,6S)-3,4-diacetyloxy-6-ethylsulfanyl-5-fluorooxan-2-yl]methyl acetate (PubChem CID 69115622) has the molecular formula C14H21FO7S and a molecular weight of 352.38 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4-diacetyloxy-6-ethylsulfanyl-5-fluorooxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4-diacetyloxy-6-ethylsulfanyl-5-fluorooxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 69115622 |
| Molecular Formula | C14H21FO7S |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4-diacetyloxy-6-ethylsulfanyl-5-fluorooxan-2-yl]methyl acetate |
| SMILES | CCS[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1F |
| InChI | InChI=1S/C14H21FO7S/c1-5-23-14-11(15)13(21-9(4)18)12(20-8(3)17)10(22-14)6-19-7(2)16/h10-14H,5-6H2,1-4H3/t10-,11-,12-,13-,14+/m1/s1 |
| InChIKey | ZSGCOFJDKTZXGR-KSTCHIGDSA-N |
| XLogP | 1.23 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|