C10H15NS — CID 69115709
azane;2,3,4,5-tetrahydro-1-benzothiepine (PubChem CID 69115709) has the molecular formula C10H15NS and a molecular weight of 181.30 g/mol. Its IUPAC name is azane;2,3,4,5-tetrahydro-1-benzothiepine.
| Compound Name | azane;2,3,4,5-tetrahydro-1-benzothiepine |
|---|---|
| PubChem CID | 69115709 |
| Molecular Formula | C10H15NS |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | azane;2,3,4,5-tetrahydro-1-benzothiepine |
| SMILES | N.c1ccc2c(c1)CCCCS2 |
| InChI | InChI=1S/C10H12S.H3N/c1-2-7-10-9(5-1)6-3-4-8-11-10;/h1-2,5,7H,3-4,6,8H2;1H3 |
| InChIKey | SCAATKFWGDZXKR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |