C12H16O3 — CID 69115976
methyl 3-(2-ethyl-4-hydroxyphenyl)propanoate (PubChem CID 69115976) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is methyl 3-(2-ethyl-4-hydroxyphenyl)propanoate.
| Compound Name | methyl 3-(2-ethyl-4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 69115976 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | methyl 3-(2-ethyl-4-hydroxyphenyl)propanoate |
| SMILES | CCc1cc(O)ccc1CCC(=O)OC |
| InChI | InChI=1S/C12H16O3/c1-3-9-8-11(13)6-4-10(9)5-7-12(14)15-2/h4,6,8,13H,3,5,7H2,1-2H3 |
| InChIKey | ZAGMLJLALQHDOR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |