C23H34Cl2FN3O6 — CID 69115990
4-[4-[bis(2-chloroethyl)amino]phenyl]-N-[3-[[(2R,3S,4S,5S,6R)-3-fluoro-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]-3-oxopropyl]butanamide (PubChem CID 69115990) has the molecular formula C23H34Cl2FN3O6 and a molecular weight of 538.44 g/mol. Its IUPAC name is 4-[4-[bis(2-chloroethyl)amino]phenyl]-N-[3-[[(2R,3S,4S,5S,6R)-3-fluoro-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]-3-oxopropyl]butanamide.
| Compound Name | 4-[4-[bis(2-chloroethyl)amino]phenyl]-N-[3-[[(2R,3S,4S,5S,6R)-3-fluoro-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]-3-oxopropyl]butanamide |
|---|---|
| PubChem CID | 69115990 |
| Molecular Formula | C23H34Cl2FN3O6 |
| Molecular Weight | 538.44 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | 4-[4-[bis(2-chloroethyl)amino]phenyl]-N-[3-[[(2R,3S,4S,5S,6R)-3-fluoro-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]-3-oxopropyl]butanamide |
| SMILES | O=C(CCCc1ccc(N(CCCl)CCCl)cc1)NCCC(=O)N[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1F |
| InChI | InChI=1S/C23H34Cl2FN3O6/c24-9-12-29(13-10-25)16-6-4-15(5-7-16)2-1-3-18(31)27-11-8-19(32)28-23-20(26)22(34)21(33)17(14-30)35-23/h4-7,17,20-23,30,33-34H,1-3,8-14H2,(H,27,31)(H,28,32)/t17-,20+,21-,22-,23-/m1/s1 |
| InChIKey | AKJBOAJFRLIAGV-UYOMMXDPSA-N |
| XLogP | 0.69 |
| TPSA | 131.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.44 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|