C20H30N4O3 — CID 69116044
tert-butyl N-[1-(6-pyrrolidin-1-ylpyridine-3-carbonyl)piperidin-4-yl]carbamate (PubChem CID 69116044) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is tert-butyl N-[1-(6-pyrrolidin-1-ylpyridine-3-carbonyl)piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(6-pyrrolidin-1-ylpyridine-3-carbonyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 69116044 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | tert-butyl N-[1-(6-pyrrolidin-1-ylpyridine-3-carbonyl)piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(C(=O)c2ccc(N3CCCC3)nc2)CC1 |
| InChI | InChI=1S/C20H30N4O3/c1-20(2,3)27-19(26)22-16-8-12-24(13-9-16)18(25)15-6-7-17(21-14-15)23-10-4-5-11-23/h6-7,14,16H,4-5,8-13H2,1-3H3,(H,22,26) |
| InChIKey | HHLCHYRWFXHNRO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |