C19H30O9S — CID 69116520
[(2R)-2-[(2R,3S,4R,5S)-5-methylsulfanyl-3,4-di(propanoyloxy)oxolan-2-yl]-2-propanoyloxyethyl] propanoate (PubChem CID 69116520) has the molecular formula C19H30O9S and a molecular weight of 434.51 g/mol. Its IUPAC name is [(2R)-2-[(2R,3S,4R,5S)-5-methylsulfanyl-3,4-di(propanoyloxy)oxolan-2-yl]-2-propanoyloxyethyl] propanoate.
| Compound Name | [(2R)-2-[(2R,3S,4R,5S)-5-methylsulfanyl-3,4-di(propanoyloxy)oxolan-2-yl]-2-propanoyloxyethyl] propanoate |
|---|---|
| PubChem CID | 69116520 |
| Molecular Formula | C19H30O9S |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | [(2R)-2-[(2R,3S,4R,5S)-5-methylsulfanyl-3,4-di(propanoyloxy)oxolan-2-yl]-2-propanoyloxyethyl] propanoate |
| SMILES | CCC(=O)OC[C@@H](OC(=O)CC)[C@H]1O[C@@H](SC)[C@H](OC(=O)CC)[C@H]1OC(=O)CC |
| InChI | InChI=1S/C19H30O9S/c1-6-12(20)24-10-11(25-13(21)7-2)16-17(26-14(22)8-3)18(19(28-16)29-5)27-15(23)9-4/h11,16-19H,6-10H2,1-5H3/t11-,16-,17+,18-,19+/m1/s1 |
| InChIKey | UJMHJSVQAGDQKC-ZMKKGPNFSA-N |
| XLogP | 1.99 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|