C28H29NO6 — CID 69117244
6-[2-[2-(1,3-benzodioxol-4-yl)-2-methylpropyl]-2-hydroxyoct-3-ynoyl]-4-methyl-2,3-benzoxazin-1-one (PubChem CID 69117244) has the molecular formula C28H29NO6 and a molecular weight of 475.54 g/mol. Its IUPAC name is 6-[2-[2-(1,3-benzodioxol-4-yl)-2-methylpropyl]-2-hydroxyoct-3-ynoyl]-4-methyl-2,3-benzoxazin-1-one.
| Compound Name | 6-[2-[2-(1,3-benzodioxol-4-yl)-2-methylpropyl]-2-hydroxyoct-3-ynoyl]-4-methyl-2,3-benzoxazin-1-one |
|---|---|
| PubChem CID | 69117244 |
| Molecular Formula | C28H29NO6 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 6-[2-[2-(1,3-benzodioxol-4-yl)-2-methylpropyl]-2-hydroxyoct-3-ynoyl]-4-methyl-2,3-benzoxazin-1-one |
| SMILES | CCCCC#CC(O)(CC(C)(C)c1cccc2c1OCO2)C(=O)c1ccc2c(=O)onc(C)c2c1 |
| InChI | InChI=1S/C28H29NO6/c1-5-6-7-8-14-28(32,16-27(3,4)22-10-9-11-23-24(22)34-17-33-23)25(30)19-12-13-20-21(15-19)18(2)29-35-26(20)31/h9-13,15,32H,5-7,16-17H2,1-4H3 |
| InChIKey | RXNITYVQTWMORI-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 98.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|