C43H50BrFN2O5Si — CID 69117821
(4S)-3-[(2R,5S)-2-[(S)-anilino-(4-bromo-2-prop-2-enoxyphenyl)methyl]-5-[tert-butyl(dimethyl)silyl]oxy-5-(4-fluorophenyl)pentanoyl]-4-benzyl-1,3-oxazolidin-2-one (PubChem CID 69117821) has the molecular formula C43H50BrFN2O5Si and a molecular weight of 801.87 g/mol. Its IUPAC name is (4S)-3-[(2R,5S)-2-[(S)-anilino-(4-bromo-2-prop-2-enoxyphenyl)methyl]-5-[tert-butyl(dimethyl)silyl]oxy-5-(4-fluorophenyl)pentanoyl]-4-benzyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(2R,5S)-2-[(S)-anilino-(4-bromo-2-prop-2-enoxyphenyl)methyl]-5-[tert-butyl(dimethyl)silyl]oxy-5-(4-fluorophenyl)pentanoyl]-4-benzyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 69117821 |
| Molecular Formula | C43H50BrFN2O5Si |
| Molecular Weight | 801.87 g/mol |
| Exact Mass | 800.27 |
| IUPAC Name | (4S)-3-[(2R,5S)-2-[(S)-anilino-(4-bromo-2-prop-2-enoxyphenyl)methyl]-5-[tert-butyl(dimethyl)silyl]oxy-5-(4-fluorophenyl)pentanoyl]-4-benzyl-1,3-oxazolidin-2-one |
| SMILES | C=CCOc1cc(Br)ccc1[C@@H](Nc1ccccc1)[C@@H](CC[C@H](O[Si](C)(C)C(C)(C)C)c1ccc(F)cc1)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C43H50BrFN2O5Si/c1-7-26-50-39-28-32(44)20-23-36(39)40(46-34-16-12-9-13-17-34)37(41(48)47-35(29-51-42(47)49)27-30-14-10-8-11-15-30)24-25-38(31-18-21-33(45)22-19-31)52-53(5,6)43(2,3)4/h7-23,28,35,37-38,40,46H,1,24-27,29H2,2-6H3/t35-,37+,38-,40+/m0/s1 |
| InChIKey | VFOMYWYPEHNNGG-HWRYGASLSA-N |
| XLogP | 11.06 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.87 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|