About CID 69117879
CID 69117879 (PubChem CID 69117879) has the molecular formula C7H7NNaOS
and a molecular weight of 176.20 g/mol.
Molecular Properties
| Compound Name | CID 69117879 |
| PubChem CID | 69117879 |
| Molecular Formula | C7H7NNaOS |
| Molecular Weight | 176.20 g/mol |
| Exact Mass | 176.01 |
| IUPAC Name | — |
| SMILES | O=S1CNc2ccccc21.[Na] |
| InChI | InChI=1S/C7H7NOS.Na/c9-10-5-8-6-3-1-2-4-7(6)10;/h1-4,8H,5H2; |
| InChIKey | YOJFNBASDLJBOM-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.20 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 69117879 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 69117879?
The IUPAC name of CID 69117879 (CID 69117879) is not available.
What is the SMILES notation for CID 69117879?
The canonical SMILES for CID 69117879 is O=S1CNc2ccccc21.[Na].
What is the InChIKey of CID 69117879?
The InChIKey is YOJFNBASDLJBOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NOS.Na/c9-10-5-8-6-3-1-2-4-7(6)10;/h1-4,8H,5H2;.
What are the key properties of CID 69117879?
CID 69117879 has a molecular weight of 176.20 g/mol, XLogP of 0.80, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 69117879 is sourced from PubChem (CID 69117879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).