About 4-[1-[4-(diethylamino)-2-ethylphenyl]-1-(4-methylphenyl)ethyl]-N,N,3-triethylaniline
4-[1-[4-(diethylamino)-2-ethylphenyl]-1-(4-methylphenyl)ethyl]-N,N,3-triethylaniline (PubChem CID 69118407) has the molecular formula C33H46N2
and a molecular weight of 470.75 g/mol. Its IUPAC name is 4-[1-[4-(diethylamino)-2-ethylphenyl]-1-(4-methylphenyl)ethyl]-N,N,3-triethylaniline.
Molecular Properties
| Compound Name | 4-[1-[4-(diethylamino)-2-ethylphenyl]-1-(4-methylphenyl)ethyl]-N,N,3-triethylaniline |
| PubChem CID | 69118407 |
| Molecular Formula | C33H46N2 |
| Molecular Weight | 470.75 g/mol |
| Exact Mass | 470.37 |
| IUPAC Name | 4-[1-[4-(diethylamino)-2-ethylphenyl]-1-(4-methylphenyl)ethyl]-N,N,3-triethylaniline |
| SMILES | CCc1cc(N(CC)CC)ccc1C(C)(c1ccc(C)cc1)c1ccc(N(CC)CC)cc1CC |
| InChI | InChI=1S/C33H46N2/c1-9-26-23-29(34(11-3)12-4)19-21-31(26)33(8,28-17-15-25(7)16-18-28)32-22-20-30(24-27(32)10-2)35(13-5)14-6/h15-24H,9-14H2,1-8H3 |
| InChIKey | UAZITWNDKDBBKD-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.75 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-[4-(diethylamino)-2-ethylphenyl]-1-(4-methylphenyl)ethyl]-N,N,3-triethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-[4-(diethylamino)-2-ethylphenyl]-1-(4-methylphenyl)ethyl]-N,N,3-triethylaniline?
The IUPAC name of 4-[1-[4-(diethylamino)-2-ethylphenyl]-1-(4-methylphenyl)ethyl]-N,N,3-triethylaniline (CID 69118407) is 4-[1-[4-(diethylamino)-2-ethylphenyl]-1-(4-methylphenyl)ethyl]-N,N,3-triethylaniline.
What is the SMILES notation for 4-[1-[4-(diethylamino)-2-ethylphenyl]-1-(4-methylphenyl)ethyl]-N,N,3-triethylaniline?
The canonical SMILES for 4-[1-[4-(diethylamino)-2-ethylphenyl]-1-(4-methylphenyl)ethyl]-N,N,3-triethylaniline is CCc1cc(N(CC)CC)ccc1C(C)(c1ccc(C)cc1)c1ccc(N(CC)CC)cc1CC.
What is the InChIKey of 4-[1-[4-(diethylamino)-2-ethylphenyl]-1-(4-methylphenyl)ethyl]-N,N,3-triethylaniline?
The InChIKey is UAZITWNDKDBBKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H46N2/c1-9-26-23-29(34(11-3)12-4)19-21-31(26)33(8,28-17-15-25(7)16-18-28)32-22-20-30(24-27(32)10-2)35(13-5)14-6/h15-24H,9-14H2,1-8H3.
What are the key properties of 4-[1-[4-(diethylamino)-2-ethylphenyl]-1-(4-methylphenyl)ethyl]-N,N,3-triethylaniline?
4-[1-[4-(diethylamino)-2-ethylphenyl]-1-(4-methylphenyl)ethyl]-N,N,3-triethylaniline has a molecular weight of 470.75 g/mol, XLogP of 8.17, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-[4-(diethylamino)-2-ethylphenyl]-1-(4-methylphenyl)ethyl]-N,N,3-triethylaniline is sourced from PubChem (CID 69118407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).