About 1H-indole-2,3-dione;2-(methylamino)acetic acid
1H-indole-2,3-dione;2-(methylamino)acetic acid (PubChem CID 69118743) has the molecular formula C11H12N2O4
and a molecular weight of 236.23 g/mol. Its IUPAC name is 1H-indole-2,3-dione;2-(methylamino)acetic acid.
Molecular Properties
| Compound Name | 1H-indole-2,3-dione;2-(methylamino)acetic acid |
| PubChem CID | 69118743 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 1H-indole-2,3-dione;2-(methylamino)acetic acid |
| SMILES | CNCC(=O)O.O=C1Nc2ccccc2C1=O |
| InChI | InChI=1S/C8H5NO2.C3H7NO2/c10-7-5-3-1-2-4-6(5)9-8(7)11;1-4-2-3(5)6/h1-4H,(H,9,10,11);4H,2H2,1H3,(H,5,6) |
| InChIKey | XDNNKRJTDLTHDO-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1H-indole-2,3-dione;2-(methylamino)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole-2,3-dione;2-(methylamino)acetic acid?
The IUPAC name of 1H-indole-2,3-dione;2-(methylamino)acetic acid (CID 69118743) is 1H-indole-2,3-dione;2-(methylamino)acetic acid.
What is the SMILES notation for 1H-indole-2,3-dione;2-(methylamino)acetic acid?
The canonical SMILES for 1H-indole-2,3-dione;2-(methylamino)acetic acid is CNCC(=O)O.O=C1Nc2ccccc2C1=O.
What is the InChIKey of 1H-indole-2,3-dione;2-(methylamino)acetic acid?
The InChIKey is XDNNKRJTDLTHDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO2.C3H7NO2/c10-7-5-3-1-2-4-6(5)9-8(7)11;1-4-2-3(5)6/h1-4H,(H,9,10,11);4H,2H2,1H3,(H,5,6).
What are the key properties of 1H-indole-2,3-dione;2-(methylamino)acetic acid?
1H-indole-2,3-dione;2-(methylamino)acetic acid has a molecular weight of 236.23 g/mol, XLogP of 0.11, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole-2,3-dione;2-(methylamino)acetic acid is sourced from PubChem (CID 69118743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).