About phosphobenzene
phosphobenzene (PubChem CID 6911879) has the molecular formula C6H5O2P
and a molecular weight of 140.08 g/mol. Its IUPAC name is phosphobenzene.
Molecular Properties
| Compound Name | phosphobenzene |
| PubChem CID | 6911879 |
| Molecular Formula | C6H5O2P |
| Molecular Weight | 140.08 g/mol |
| Exact Mass | 140.00 |
| IUPAC Name | phosphobenzene |
| SMILES | O=P(=O)c1ccccc1 |
| InChI | InChI=1S/C6H5O2P/c7-9(8)6-4-2-1-3-5-6/h1-5H |
| InChIKey | KNQVWTDLQQGKSV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.08 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phosphobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phosphobenzene?
The IUPAC name of phosphobenzene (CID 6911879) is phosphobenzene.
What is the SMILES notation for phosphobenzene?
The canonical SMILES for phosphobenzene is O=P(=O)c1ccccc1.
What is the InChIKey of phosphobenzene?
The InChIKey is KNQVWTDLQQGKSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5O2P/c7-9(8)6-4-2-1-3-5-6/h1-5H.
What are the key properties of phosphobenzene?
phosphobenzene has a molecular weight of 140.08 g/mol, XLogP of 1.48, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phosphobenzene is sourced from PubChem (CID 6911879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).