About [(2R,5S)-5-(hydroxymethyl)oxolan-2-yl] dihydrogen phosphate
[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl] dihydrogen phosphate (PubChem CID 69118795) has the molecular formula C5H11O6P
and a molecular weight of 198.11 g/mol. Its IUPAC name is [(2R,5S)-5-(hydroxymethyl)oxolan-2-yl] dihydrogen phosphate.
Molecular Properties
| Compound Name | [(2R,5S)-5-(hydroxymethyl)oxolan-2-yl] dihydrogen phosphate |
| PubChem CID | 69118795 |
| Molecular Formula | C5H11O6P |
| Molecular Weight | 198.11 g/mol |
| Exact Mass | 198.03 |
| IUPAC Name | [(2R,5S)-5-(hydroxymethyl)oxolan-2-yl] dihydrogen phosphate |
| SMILES | O=P(O)(O)O[C@@H]1CC[C@@H](CO)O1 |
| InChI | InChI=1S/C5H11O6P/c6-3-4-1-2-5(10-4)11-12(7,8)9/h4-6H,1-3H2,(H2,7,8,9)/t4-,5+/m0/s1 |
| InChIKey | XYWDMVGRKLPPRF-CRCLSJGQSA-N |
| XLogP | -0.41 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.11 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(2R,5S)-5-(hydroxymethyl)oxolan-2-yl] dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,5S)-5-(hydroxymethyl)oxolan-2-yl] dihydrogen phosphate?
The IUPAC name of [(2R,5S)-5-(hydroxymethyl)oxolan-2-yl] dihydrogen phosphate (CID 69118795) is [(2R,5S)-5-(hydroxymethyl)oxolan-2-yl] dihydrogen phosphate.
What is the SMILES notation for [(2R,5S)-5-(hydroxymethyl)oxolan-2-yl] dihydrogen phosphate?
The canonical SMILES for [(2R,5S)-5-(hydroxymethyl)oxolan-2-yl] dihydrogen phosphate is O=P(O)(O)O[C@@H]1CC[C@@H](CO)O1.
What is the InChIKey of [(2R,5S)-5-(hydroxymethyl)oxolan-2-yl] dihydrogen phosphate?
The InChIKey is XYWDMVGRKLPPRF-CRCLSJGQSA-N. The full InChI is InChI=1S/C5H11O6P/c6-3-4-1-2-5(10-4)11-12(7,8)9/h4-6H,1-3H2,(H2,7,8,9)/t4-,5+/m0/s1.
What are the key properties of [(2R,5S)-5-(hydroxymethyl)oxolan-2-yl] dihydrogen phosphate?
[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl] dihydrogen phosphate has a molecular weight of 198.11 g/mol, XLogP of -0.41, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,5S)-5-(hydroxymethyl)oxolan-2-yl] dihydrogen phosphate is sourced from PubChem (CID 69118795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).