C19H29NO4 — CID 69118879
(1R,4S,5R,6R)-2-hexyl-7-phenyl-2-azabicyclo[4.2.0]octane-4,5,6,8-tetrol (PubChem CID 69118879) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is (1R,4S,5R,6R)-2-hexyl-7-phenyl-2-azabicyclo[4.2.0]octane-4,5,6,8-tetrol.
| Compound Name | (1R,4S,5R,6R)-2-hexyl-7-phenyl-2-azabicyclo[4.2.0]octane-4,5,6,8-tetrol |
|---|---|
| PubChem CID | 69118879 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | (1R,4S,5R,6R)-2-hexyl-7-phenyl-2-azabicyclo[4.2.0]octane-4,5,6,8-tetrol |
| SMILES | CCCCCCN1C[C@H](O)[C@@H](O)[C@@]2(O)C(c3ccccc3)C(O)[C@@H]12 |
| InChI | InChI=1S/C19H29NO4/c1-2-3-4-8-11-20-12-14(21)18(23)19(24)15(16(22)17(19)20)13-9-6-5-7-10-13/h5-7,9-10,14-18,21-24H,2-4,8,11-12H2,1H3/t14-,15?,16?,17+,18+,19+/m0/s1 |
| InChIKey | KFXGATSIJNTZJJ-KOIGKCLASA-N |
| XLogP | 0.86 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|