C28H41NO3S — CID 69119361
N-benzyl-6-[4-(3-cyclopentylsulfonylphenyl)butoxy]hexan-1-amine (PubChem CID 69119361) has the molecular formula C28H41NO3S and a molecular weight of 471.71 g/mol. Its IUPAC name is N-benzyl-6-[4-(3-cyclopentylsulfonylphenyl)butoxy]hexan-1-amine.
| Compound Name | N-benzyl-6-[4-(3-cyclopentylsulfonylphenyl)butoxy]hexan-1-amine |
|---|---|
| PubChem CID | 69119361 |
| Molecular Formula | C28H41NO3S |
| Molecular Weight | 471.71 g/mol |
| Exact Mass | 471.28 |
| IUPAC Name | N-benzyl-6-[4-(3-cyclopentylsulfonylphenyl)butoxy]hexan-1-amine |
| SMILES | O=S(=O)(c1cccc(CCCCOCCCCCCNCc2ccccc2)c1)C1CCCC1 |
| InChI | InChI=1S/C28H41NO3S/c30-33(31,27-17-6-7-18-27)28-19-12-16-25(23-28)13-8-11-22-32-21-10-2-1-9-20-29-24-26-14-4-3-5-15-26/h3-5,12,14-16,19,23,27,29H,1-2,6-11,13,17-18,20-22,24H2 |
| InChIKey | VIEYOTMJTLNTQE-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.71 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|