C25H31NO6 — CID 69119379
2-[1-ethoxy-3-oxo-2-[6-(2,4,6-trimethylphenyl)-2-pyridinyl]hexyl]propanedioic acid (PubChem CID 69119379) has the molecular formula C25H31NO6 and a molecular weight of 441.52 g/mol. Its IUPAC name is 2-[1-ethoxy-3-oxo-2-[6-(2,4,6-trimethylphenyl)-2-pyridinyl]hexyl]propanedioic acid.
| Compound Name | 2-[1-ethoxy-3-oxo-2-[6-(2,4,6-trimethylphenyl)-2-pyridinyl]hexyl]propanedioic acid |
|---|---|
| PubChem CID | 69119379 |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 2-[1-ethoxy-3-oxo-2-[6-(2,4,6-trimethylphenyl)-2-pyridinyl]hexyl]propanedioic acid |
| SMILES | CCCC(=O)C(c1cccc(-c2c(C)cc(C)cc2C)n1)C(OCC)C(C(=O)O)C(=O)O |
| InChI | InChI=1S/C25H31NO6/c1-6-9-19(27)21(23(32-7-2)22(24(28)29)25(30)31)18-11-8-10-17(26-18)20-15(4)12-14(3)13-16(20)5/h8,10-13,21-23H,6-7,9H2,1-5H3,(H,28,29)(H,30,31) |
| InChIKey | YTKWTCBYPKGKQI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 113.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|