About 5-[(2-bromophenyl)methyl]-1H-imidazole;5-[(2,6-dimethylphenyl)methyl]-1H-imidazole
5-[(2-bromophenyl)methyl]-1H-imidazole;5-[(2,6-dimethylphenyl)methyl]-1H-imidazole (PubChem CID 69119670) has the molecular formula C22H23BrN4
and a molecular weight of 423.36 g/mol. Its IUPAC name is 5-[(2-bromophenyl)methyl]-1H-imidazole;5-[(2,6-dimethylphenyl)methyl]-1H-imidazole.
Molecular Properties
| Compound Name | 5-[(2-bromophenyl)methyl]-1H-imidazole;5-[(2,6-dimethylphenyl)methyl]-1H-imidazole |
| PubChem CID | 69119670 |
| Molecular Formula | C22H23BrN4 |
| Molecular Weight | 423.36 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 5-[(2-bromophenyl)methyl]-1H-imidazole;5-[(2,6-dimethylphenyl)methyl]-1H-imidazole |
| SMILES | Brc1ccccc1Cc1cnc[nH]1.Cc1cccc(C)c1Cc1cnc[nH]1 |
| InChI | InChI=1S/C12H14N2.C10H9BrN2/c1-9-4-3-5-10(2)12(9)6-11-7-13-8-14-11;11-10-4-2-1-3-8(10)5-9-6-12-7-13-9/h3-5,7-8H,6H2,1-2H3,(H,13,14);1-4,6-7H,5H2,(H,12,13) |
| InChIKey | SGXXCSMJSXKOGI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.36 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(2-bromophenyl)methyl]-1H-imidazole;5-[(2,6-dimethylphenyl)methyl]-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-bromophenyl)methyl]-1H-imidazole;5-[(2,6-dimethylphenyl)methyl]-1H-imidazole?
The IUPAC name of 5-[(2-bromophenyl)methyl]-1H-imidazole;5-[(2,6-dimethylphenyl)methyl]-1H-imidazole (CID 69119670) is 5-[(2-bromophenyl)methyl]-1H-imidazole;5-[(2,6-dimethylphenyl)methyl]-1H-imidazole.
What is the SMILES notation for 5-[(2-bromophenyl)methyl]-1H-imidazole;5-[(2,6-dimethylphenyl)methyl]-1H-imidazole?
The canonical SMILES for 5-[(2-bromophenyl)methyl]-1H-imidazole;5-[(2,6-dimethylphenyl)methyl]-1H-imidazole is Brc1ccccc1Cc1cnc[nH]1.Cc1cccc(C)c1Cc1cnc[nH]1.
What is the InChIKey of 5-[(2-bromophenyl)methyl]-1H-imidazole;5-[(2,6-dimethylphenyl)methyl]-1H-imidazole?
The InChIKey is SGXXCSMJSXKOGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2.C10H9BrN2/c1-9-4-3-5-10(2)12(9)6-11-7-13-8-14-11;11-10-4-2-1-3-8(10)5-9-6-12-7-13-9/h3-5,7-8H,6H2,1-2H3,(H,13,14);1-4,6-7H,5H2,(H,12,13).
What are the key properties of 5-[(2-bromophenyl)methyl]-1H-imidazole;5-[(2,6-dimethylphenyl)methyl]-1H-imidazole?
5-[(2-bromophenyl)methyl]-1H-imidazole;5-[(2,6-dimethylphenyl)methyl]-1H-imidazole has a molecular weight of 423.36 g/mol, XLogP of 5.38, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-bromophenyl)methyl]-1H-imidazole;5-[(2,6-dimethylphenyl)methyl]-1H-imidazole is sourced from PubChem (CID 69119670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).