About (5E)-5-(iodomethylidene)-3,4-dimethyloxan-2-one
(5E)-5-(iodomethylidene)-3,4-dimethyloxan-2-one (PubChem CID 69120131) has the molecular formula C8H11IO2
and a molecular weight of 266.08 g/mol. Its IUPAC name is (5E)-5-(iodomethylidene)-3,4-dimethyloxan-2-one.
Molecular Properties
| Compound Name | (5E)-5-(iodomethylidene)-3,4-dimethyloxan-2-one |
| PubChem CID | 69120131 |
| Molecular Formula | C8H11IO2 |
| Molecular Weight | 266.08 g/mol |
| Exact Mass | 265.98 |
| IUPAC Name | (5E)-5-(iodomethylidene)-3,4-dimethyloxan-2-one |
| SMILES | CC1C(=O)OC/C(=C/I)C1C |
| InChI | InChI=1S/C8H11IO2/c1-5-6(2)8(10)11-4-7(5)3-9/h3,5-6H,4H2,1-2H3/b7-3- |
| InChIKey | HCLIRHQQUUHEAX-CLTKARDFSA-N |
| XLogP | 2.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.08 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (5E)-5-(iodomethylidene)-3,4-dimethyloxan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-5-(iodomethylidene)-3,4-dimethyloxan-2-one?
The IUPAC name of (5E)-5-(iodomethylidene)-3,4-dimethyloxan-2-one (CID 69120131) is (5E)-5-(iodomethylidene)-3,4-dimethyloxan-2-one.
What is the SMILES notation for (5E)-5-(iodomethylidene)-3,4-dimethyloxan-2-one?
The canonical SMILES for (5E)-5-(iodomethylidene)-3,4-dimethyloxan-2-one is CC1C(=O)OC/C(=C/I)C1C.
What is the InChIKey of (5E)-5-(iodomethylidene)-3,4-dimethyloxan-2-one?
The InChIKey is HCLIRHQQUUHEAX-CLTKARDFSA-N. The full InChI is InChI=1S/C8H11IO2/c1-5-6(2)8(10)11-4-7(5)3-9/h3,5-6H,4H2,1-2H3/b7-3-.
What are the key properties of (5E)-5-(iodomethylidene)-3,4-dimethyloxan-2-one?
(5E)-5-(iodomethylidene)-3,4-dimethyloxan-2-one has a molecular weight of 266.08 g/mol, XLogP of 2.13, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-5-(iodomethylidene)-3,4-dimethyloxan-2-one is sourced from PubChem (CID 69120131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).