About 2-deuterionaphthalene
2-deuterionaphthalene (PubChem CID 6912029) has the molecular formula C10H8
and a molecular weight of 129.18 g/mol. Its IUPAC name is 2-deuterionaphthalene.
Molecular Properties
| Compound Name | 2-deuterionaphthalene |
| PubChem CID | 6912029 |
| Molecular Formula | C10H8 |
| Molecular Weight | 129.18 g/mol |
| Exact Mass | 129.07 |
| IUPAC Name | 2-deuterionaphthalene |
| SMILES | [2H]c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8/c1-2-6-10-8-4-3-7-9(10)5-1/h1-8H/i1D |
| InChIKey | UFWIBTONFRDIAS-MICDWDOJSA-N |
| XLogP | 2.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.18 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-deuterionaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-deuterionaphthalene?
The IUPAC name of 2-deuterionaphthalene (CID 6912029) is 2-deuterionaphthalene.
What is the SMILES notation for 2-deuterionaphthalene?
The canonical SMILES for 2-deuterionaphthalene is [2H]c1ccc2ccccc2c1.
What is the InChIKey of 2-deuterionaphthalene?
The InChIKey is UFWIBTONFRDIAS-MICDWDOJSA-N. The full InChI is InChI=1S/C10H8/c1-2-6-10-8-4-3-7-9(10)5-1/h1-8H/i1D.
What are the key properties of 2-deuterionaphthalene?
2-deuterionaphthalene has a molecular weight of 129.18 g/mol, XLogP of 2.84, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-deuterionaphthalene is sourced from PubChem (CID 6912029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).