C19H21NO5 — CID 69120373
4-(3-cyclopentyloxyphenoxy)benzamide;formic acid (PubChem CID 69120373) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is 4-(3-cyclopentyloxyphenoxy)benzamide;formic acid.
| Compound Name | 4-(3-cyclopentyloxyphenoxy)benzamide;formic acid |
|---|---|
| PubChem CID | 69120373 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 4-(3-cyclopentyloxyphenoxy)benzamide;formic acid |
| SMILES | NC(=O)c1ccc(Oc2cccc(OC3CCCC3)c2)cc1.O=CO |
| InChI | InChI=1S/C18H19NO3.CH2O2/c19-18(20)13-8-10-15(11-9-13)22-17-7-3-6-16(12-17)21-14-4-1-2-5-14;2-1-3/h3,6-12,14H,1-2,4-5H2,(H2,19,20);1H,(H,2,3) |
| InChIKey | LVNJDDUGSFMCSS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|