4-(3-cyclopentyloxyphenoxy)benzamide;formic acid

C19H21NO5 — CID 69120373

IUPAC4-(3-cyclopentyloxyphenoxy)benzamide;formic acid
SMILESNC(=O)c1ccc(Oc2cccc(OC3CCCC3)c2)cc1.O=CO
InChIInChI=1S/C18H19NO3.CH2O2/c19-18(20)13-8-10-15(11-9-13)22-17-7-3-6-16(12-17)21-14-4-1-2-5-14;2-1-3/h3,6-12,14H,1-2,4-5H2,(H2,19,20);1H,(H,2,3)
InChIKeyLVNJDDUGSFMCSS-UHFFFAOYSA-N
MW343.38 g/mol
LogP3.60
Rot. Bonds5

About 4-(3-cyclopentyloxyphenoxy)benzamide;formic acid

4-(3-cyclopentyloxyphenoxy)benzamide;formic acid (PubChem CID 69120373) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is 4-(3-cyclopentyloxyphenoxy)benzamide;formic acid.

Molecular Properties

Compound Name4-(3-cyclopentyloxyphenoxy)benzamide;formic acid
PubChem CID69120373
Molecular FormulaC19H21NO5
Molecular Weight343.38 g/mol
Exact Mass343.14
IUPAC Name4-(3-cyclopentyloxyphenoxy)benzamide;formic acid
SMILESNC(=O)c1ccc(Oc2cccc(OC3CCCC3)c2)cc1.O=CO
InChIInChI=1S/C18H19NO3.CH2O2/c19-18(20)13-8-10-15(11-9-13)22-17-7-3-6-16(12-17)21-14-4-1-2-5-14;2-1-3/h3,6-12,14H,1-2,4-5H2,(H2,19,20);1H,(H,2,3)
InChIKeyLVNJDDUGSFMCSS-UHFFFAOYSA-N
XLogP3.60
TPSA98.85 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500343.38
LogP ≤ 53.60
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 4-(3-cyclopentyloxyphenoxy)benzamide;formic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3-cyclopentyloxyphenoxy)benzamide;formic acid?
The IUPAC name of 4-(3-cyclopentyloxyphenoxy)benzamide;formic acid (CID 69120373) is 4-(3-cyclopentyloxyphenoxy)benzamide;formic acid.
What is the SMILES notation for 4-(3-cyclopentyloxyphenoxy)benzamide;formic acid?
The canonical SMILES for 4-(3-cyclopentyloxyphenoxy)benzamide;formic acid is NC(=O)c1ccc(Oc2cccc(OC3CCCC3)c2)cc1.O=CO.
What is the InChIKey of 4-(3-cyclopentyloxyphenoxy)benzamide;formic acid?
The InChIKey is LVNJDDUGSFMCSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO3.CH2O2/c19-18(20)13-8-10-15(11-9-13)22-17-7-3-6-16(12-17)21-14-4-1-2-5-14;2-1-3/h3,6-12,14H,1-2,4-5H2,(H2,19,20);1H,(H,2,3).
What are the key properties of 4-(3-cyclopentyloxyphenoxy)benzamide;formic acid?
4-(3-cyclopentyloxyphenoxy)benzamide;formic acid has a molecular weight of 343.38 g/mol, XLogP of 3.60, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-cyclopentyloxyphenoxy)benzamide;formic acid is sourced from PubChem (CID 69120373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).