C12H17N — CID 69120580
1-prop-2-enyl-3,4,4a,5-tetrahydro-2H-quinoline (PubChem CID 69120580) has the molecular formula C12H17N and a molecular weight of 175.28 g/mol. Its IUPAC name is 1-prop-2-enyl-3,4,4a,5-tetrahydro-2H-quinoline.
| Compound Name | 1-prop-2-enyl-3,4,4a,5-tetrahydro-2H-quinoline |
|---|---|
| PubChem CID | 69120580 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 1-prop-2-enyl-3,4,4a,5-tetrahydro-2H-quinoline |
| SMILES | C=CCN1CCCC2CC=CC=C21 |
| InChI | InChI=1S/C12H17N/c1-2-9-13-10-5-7-11-6-3-4-8-12(11)13/h2-4,8,11H,1,5-7,9-10H2 |
| InChIKey | ZHTRXXVWYSRRJA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|