About 5H-1,3-diazepine-4-carboxylic acid
5H-1,3-diazepine-4-carboxylic acid (PubChem CID 69121664) has the molecular formula C6H6N2O2
and a molecular weight of 138.13 g/mol. Its IUPAC name is 5H-1,3-diazepine-4-carboxylic acid.
Molecular Properties
| Compound Name | 5H-1,3-diazepine-4-carboxylic acid |
| PubChem CID | 69121664 |
| Molecular Formula | C6H6N2O2 |
| Molecular Weight | 138.13 g/mol |
| Exact Mass | 138.04 |
| IUPAC Name | 5H-1,3-diazepine-4-carboxylic acid |
| SMILES | O=C(O)C1=NC=NC=CC1 |
| InChI | InChI=1S/C6H6N2O2/c9-6(10)5-2-1-3-7-4-8-5/h1,3-4H,2H2,(H,9,10) |
| InChIKey | KTHHJFOCJVGXIY-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 62.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.13 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5H-1,3-diazepine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-1,3-diazepine-4-carboxylic acid?
The IUPAC name of 5H-1,3-diazepine-4-carboxylic acid (CID 69121664) is 5H-1,3-diazepine-4-carboxylic acid.
What is the SMILES notation for 5H-1,3-diazepine-4-carboxylic acid?
The canonical SMILES for 5H-1,3-diazepine-4-carboxylic acid is O=C(O)C1=NC=NC=CC1.
What is the InChIKey of 5H-1,3-diazepine-4-carboxylic acid?
The InChIKey is KTHHJFOCJVGXIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O2/c9-6(10)5-2-1-3-7-4-8-5/h1,3-4H,2H2,(H,9,10).
What are the key properties of 5H-1,3-diazepine-4-carboxylic acid?
5H-1,3-diazepine-4-carboxylic acid has a molecular weight of 138.13 g/mol, XLogP of 0.46, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-1,3-diazepine-4-carboxylic acid is sourced from PubChem (CID 69121664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).