methyl 2,5-dimethyl-4-(4-nitrophenyl)-1H-pyrrole-3-carboxylate

C14H14N2O4 — CID 691220

IUPACmethyl 2,5-dimethyl-4-(4-nitrophenyl)-1H-pyrrole-3-carboxylate
SMILESCOC(=O)c1c(C)[nH]c(C)c1-c1ccc([N+](=O)[O-])cc1
InChIInChI=1S/C14H14N2O4/c1-8-12(13(9(2)15-8)14(17)20-3)10-4-6-11(7-5-10)16(18)19/h4-7,15H,1-3H3
InChIKeyVNXZYZVANPQWRH-UHFFFAOYSA-N
MW274.28 g/mol
LogP2.99
Rot. Bonds3

About methyl 2,5-dimethyl-4-(4-nitrophenyl)-1H-pyrrole-3-carboxylate

methyl 2,5-dimethyl-4-(4-nitrophenyl)-1H-pyrrole-3-carboxylate (PubChem CID 691220) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is methyl 2,5-dimethyl-4-(4-nitrophenyl)-1H-pyrrole-3-carboxylate.

Molecular Properties

Compound Namemethyl 2,5-dimethyl-4-(4-nitrophenyl)-1H-pyrrole-3-carboxylate
PubChem CID691220
Molecular FormulaC14H14N2O4
Molecular Weight274.28 g/mol
Exact Mass274.10
IUPAC Namemethyl 2,5-dimethyl-4-(4-nitrophenyl)-1H-pyrrole-3-carboxylate
SMILESCOC(=O)c1c(C)[nH]c(C)c1-c1ccc([N+](=O)[O-])cc1
InChIInChI=1S/C14H14N2O4/c1-8-12(13(9(2)15-8)14(17)20-3)10-4-6-11(7-5-10)16(18)19/h4-7,15H,1-3H3
InChIKeyVNXZYZVANPQWRH-UHFFFAOYSA-N
XLogP2.99
TPSA85.23 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.28
LogP ≤ 52.99
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze methyl 2,5-dimethyl-4-(4-nitrophenyl)-1H-pyrrole-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,5-dimethyl-4-(4-nitrophenyl)-1H-pyrrole-3-carboxylate?
The IUPAC name of methyl 2,5-dimethyl-4-(4-nitrophenyl)-1H-pyrrole-3-carboxylate (CID 691220) is methyl 2,5-dimethyl-4-(4-nitrophenyl)-1H-pyrrole-3-carboxylate.
What is the SMILES notation for methyl 2,5-dimethyl-4-(4-nitrophenyl)-1H-pyrrole-3-carboxylate?
The canonical SMILES for methyl 2,5-dimethyl-4-(4-nitrophenyl)-1H-pyrrole-3-carboxylate is COC(=O)c1c(C)[nH]c(C)c1-c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of methyl 2,5-dimethyl-4-(4-nitrophenyl)-1H-pyrrole-3-carboxylate?
The InChIKey is VNXZYZVANPQWRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O4/c1-8-12(13(9(2)15-8)14(17)20-3)10-4-6-11(7-5-10)16(18)19/h4-7,15H,1-3H3.
What are the key properties of methyl 2,5-dimethyl-4-(4-nitrophenyl)-1H-pyrrole-3-carboxylate?
methyl 2,5-dimethyl-4-(4-nitrophenyl)-1H-pyrrole-3-carboxylate has a molecular weight of 274.28 g/mol, XLogP of 2.99, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,5-dimethyl-4-(4-nitrophenyl)-1H-pyrrole-3-carboxylate is sourced from PubChem (CID 691220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).