C27H29NO3 — CID 6912228
(Z)-2-[2-[2-(diethylamino)ethoxy]phenoxy]-1,3-diphenylprop-2-en-1-one (PubChem CID 6912228) has the molecular formula C27H29NO3 and a molecular weight of 415.53 g/mol. Its IUPAC name is (Z)-2-[2-[2-(diethylamino)ethoxy]phenoxy]-1,3-diphenylprop-2-en-1-one.
| Compound Name | (Z)-2-[2-[2-(diethylamino)ethoxy]phenoxy]-1,3-diphenylprop-2-en-1-one |
|---|---|
| PubChem CID | 6912228 |
| Molecular Formula | C27H29NO3 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | (Z)-2-[2-[2-(diethylamino)ethoxy]phenoxy]-1,3-diphenylprop-2-en-1-one |
| SMILES | CCN(CC)CCOc1ccccc1O/C(=C\c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C27H29NO3/c1-3-28(4-2)19-20-30-24-17-11-12-18-25(24)31-26(21-22-13-7-5-8-14-22)27(29)23-15-9-6-10-16-23/h5-18,21H,3-4,19-20H2,1-2H3/b26-21- |
| InChIKey | CNJRWHSLVBNSNT-QLYXXIJNSA-N |
| XLogP | 5.71 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|