About 4-prop-2-enyl-1,2-dihydropyridazine-3,6-dione
4-prop-2-enyl-1,2-dihydropyridazine-3,6-dione (PubChem CID 69122748) has the molecular formula C7H8N2O2
and a molecular weight of 152.15 g/mol. Its IUPAC name is 4-prop-2-enyl-1,2-dihydropyridazine-3,6-dione.
Molecular Properties
| Compound Name | 4-prop-2-enyl-1,2-dihydropyridazine-3,6-dione |
| PubChem CID | 69122748 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | 4-prop-2-enyl-1,2-dihydropyridazine-3,6-dione |
| SMILES | C=CCc1cc(=O)[nH][nH]c1=O |
| InChI | InChI=1S/C7H8N2O2/c1-2-3-5-4-6(10)8-9-7(5)11/h2,4H,1,3H2,(H,8,10)(H,9,11) |
| InChIKey | KAGYQBXZXLSORU-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-prop-2-enyl-1,2-dihydropyridazine-3,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-prop-2-enyl-1,2-dihydropyridazine-3,6-dione?
The IUPAC name of 4-prop-2-enyl-1,2-dihydropyridazine-3,6-dione (CID 69122748) is 4-prop-2-enyl-1,2-dihydropyridazine-3,6-dione.
What is the SMILES notation for 4-prop-2-enyl-1,2-dihydropyridazine-3,6-dione?
The canonical SMILES for 4-prop-2-enyl-1,2-dihydropyridazine-3,6-dione is C=CCc1cc(=O)[nH][nH]c1=O.
What is the InChIKey of 4-prop-2-enyl-1,2-dihydropyridazine-3,6-dione?
The InChIKey is KAGYQBXZXLSORU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2/c1-2-3-5-4-6(10)8-9-7(5)11/h2,4H,1,3H2,(H,8,10)(H,9,11).
What are the key properties of 4-prop-2-enyl-1,2-dihydropyridazine-3,6-dione?
4-prop-2-enyl-1,2-dihydropyridazine-3,6-dione has a molecular weight of 152.15 g/mol, XLogP of -0.21, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-prop-2-enyl-1,2-dihydropyridazine-3,6-dione is sourced from PubChem (CID 69122748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).