C30H33N5O5S — CID 69122806
3-cyclopentyl-2-[3-[[3-(3,5-dimethoxyanilino)quinoxalin-2-yl]sulfamoyl]phenyl]propanamide (PubChem CID 69122806) has the molecular formula C30H33N5O5S and a molecular weight of 575.69 g/mol. Its IUPAC name is 3-cyclopentyl-2-[3-[[3-(3,5-dimethoxyanilino)quinoxalin-2-yl]sulfamoyl]phenyl]propanamide.
| Compound Name | 3-cyclopentyl-2-[3-[[3-(3,5-dimethoxyanilino)quinoxalin-2-yl]sulfamoyl]phenyl]propanamide |
|---|---|
| PubChem CID | 69122806 |
| Molecular Formula | C30H33N5O5S |
| Molecular Weight | 575.69 g/mol |
| Exact Mass | 575.22 |
| IUPAC Name | 3-cyclopentyl-2-[3-[[3-(3,5-dimethoxyanilino)quinoxalin-2-yl]sulfamoyl]phenyl]propanamide |
| SMILES | COc1cc(Nc2nc3ccccc3nc2NS(=O)(=O)c2cccc(C(CC3CCCC3)C(N)=O)c2)cc(OC)c1 |
| InChI | InChI=1S/C30H33N5O5S/c1-39-22-16-21(17-23(18-22)40-2)32-29-30(34-27-13-6-5-12-26(27)33-29)35-41(37,38)24-11-7-10-20(15-24)25(28(31)36)14-19-8-3-4-9-19/h5-7,10-13,15-19,25H,3-4,8-9,14H2,1-2H3,(H2,31,36)(H,32,33)(H,34,35) |
| InChIKey | JULAVGKLXINRQC-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 145.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.69 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |