C15H22N2O2 — CID 69123234
8-amino-5-tert-butyl-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylic acid (PubChem CID 69123234) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 8-amino-5-tert-butyl-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylic acid.
| Compound Name | 8-amino-5-tert-butyl-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylic acid |
|---|---|
| PubChem CID | 69123234 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 8-amino-5-tert-butyl-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylic acid |
| SMILES | CC(C)(C)C1CN(C(=O)O)CCc2cc(N)ccc21 |
| InChI | InChI=1S/C15H22N2O2/c1-15(2,3)13-9-17(14(18)19)7-6-10-8-11(16)4-5-12(10)13/h4-5,8,13H,6-7,9,16H2,1-3H3,(H,18,19) |
| InChIKey | RBIVVGKBPCRFMR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|