C15H21FN2O2 — CID 69123481
7-amino-1-tert-butyl-6-fluoro-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylic acid (PubChem CID 69123481) has the molecular formula C15H21FN2O2 and a molecular weight of 280.34 g/mol. Its IUPAC name is 7-amino-1-tert-butyl-6-fluoro-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylic acid.
| Compound Name | 7-amino-1-tert-butyl-6-fluoro-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylic acid |
|---|---|
| PubChem CID | 69123481 |
| Molecular Formula | C15H21FN2O2 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 7-amino-1-tert-butyl-6-fluoro-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylic acid |
| SMILES | CC(C)(C)C1c2ccc(N)c(F)c2CCCN1C(=O)O |
| InChI | InChI=1S/C15H21FN2O2/c1-15(2,3)13-10-6-7-11(17)12(16)9(10)5-4-8-18(13)14(19)20/h6-7,13H,4-5,8,17H2,1-3H3,(H,19,20) |
| InChIKey | UEMNZLWCFVNTIV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|