C10H16N2O3 — CID 69124032
ethyl 2-(1-amino-4-methyl-6-oxo-2,3-dihydropyridin-5-yl)acetate (PubChem CID 69124032) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is ethyl 2-(1-amino-4-methyl-6-oxo-2,3-dihydropyridin-5-yl)acetate.
| Compound Name | ethyl 2-(1-amino-4-methyl-6-oxo-2,3-dihydropyridin-5-yl)acetate |
|---|---|
| PubChem CID | 69124032 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | ethyl 2-(1-amino-4-methyl-6-oxo-2,3-dihydropyridin-5-yl)acetate |
| SMILES | CCOC(=O)CC1=C(C)CCN(N)C1=O |
| InChI | InChI=1S/C10H16N2O3/c1-3-15-9(13)6-8-7(2)4-5-12(11)10(8)14/h3-6,11H2,1-2H3 |
| InChIKey | VIBJUGHPDTWYOP-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|