C17H19N3O2S — CID 69125329
2-[(3-benzyl-4,5-dihydro-3H-1,2,5-benzothiadiazepin-2-yl)oxy]acetamide (PubChem CID 69125329) has the molecular formula C17H19N3O2S and a molecular weight of 329.43 g/mol. Its IUPAC name is 2-[(3-benzyl-4,5-dihydro-3H-1,2,5-benzothiadiazepin-2-yl)oxy]acetamide.
| Compound Name | 2-[(3-benzyl-4,5-dihydro-3H-1,2,5-benzothiadiazepin-2-yl)oxy]acetamide |
|---|---|
| PubChem CID | 69125329 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 2-[(3-benzyl-4,5-dihydro-3H-1,2,5-benzothiadiazepin-2-yl)oxy]acetamide |
| SMILES | NC(=O)CON1Sc2ccccc2NCC1Cc1ccccc1 |
| InChI | InChI=1S/C17H19N3O2S/c18-17(21)12-22-20-14(10-13-6-2-1-3-7-13)11-19-15-8-4-5-9-16(15)23-20/h1-9,14,19H,10-12H2,(H2,18,21) |
| InChIKey | VWZVFHGAFDTEGB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|