C9H14O7 — CID 69127506
1-hydroxy-1-[(2S,3R,4S,5R,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]but-3-en-2-one (PubChem CID 69127506) has the molecular formula C9H14O7 and a molecular weight of 234.20 g/mol. Its IUPAC name is 1-hydroxy-1-[(2S,3R,4S,5R,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]but-3-en-2-one.
| Compound Name | 1-hydroxy-1-[(2S,3R,4S,5R,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 69127506 |
| Molecular Formula | C9H14O7 |
| Molecular Weight | 234.20 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 1-hydroxy-1-[(2S,3R,4S,5R,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]but-3-en-2-one |
| SMILES | C=CC(=O)C(O)[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C9H14O7/c1-2-3(10)4(11)8-6(13)5(12)7(14)9(15)16-8/h2,4-9,11-15H,1H2/t4?,5-,6+,7+,8+,9-/m0/s1 |
| InChIKey | ITSCJCXCOOEDFZ-FSCJDRAOSA-N |
| XLogP | -3.10 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.20 |
| LogP ≤ 5 | -3.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|