About 2-fluoro-1,3-dihexylimidazolidine
2-fluoro-1,3-dihexylimidazolidine (PubChem CID 69129645) has the molecular formula C15H31FN2
and a molecular weight of 258.42 g/mol. Its IUPAC name is 2-fluoro-1,3-dihexylimidazolidine.
Molecular Properties
| Compound Name | 2-fluoro-1,3-dihexylimidazolidine |
| PubChem CID | 69129645 |
| Molecular Formula | C15H31FN2 |
| Molecular Weight | 258.42 g/mol |
| Exact Mass | 258.25 |
| IUPAC Name | 2-fluoro-1,3-dihexylimidazolidine |
| SMILES | CCCCCCN1CCN(CCCCCC)C1F |
| InChI | InChI=1S/C15H31FN2/c1-3-5-7-9-11-17-13-14-18(15(17)16)12-10-8-6-4-2/h15H,3-14H2,1-2H3 |
| InChIKey | YXUHQXBTFAZHDR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-1,3-dihexylimidazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-1,3-dihexylimidazolidine?
The IUPAC name of 2-fluoro-1,3-dihexylimidazolidine (CID 69129645) is 2-fluoro-1,3-dihexylimidazolidine.
What is the SMILES notation for 2-fluoro-1,3-dihexylimidazolidine?
The canonical SMILES for 2-fluoro-1,3-dihexylimidazolidine is CCCCCCN1CCN(CCCCCC)C1F.
What is the InChIKey of 2-fluoro-1,3-dihexylimidazolidine?
The InChIKey is YXUHQXBTFAZHDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31FN2/c1-3-5-7-9-11-17-13-14-18(15(17)16)12-10-8-6-4-2/h15H,3-14H2,1-2H3.
What are the key properties of 2-fluoro-1,3-dihexylimidazolidine?
2-fluoro-1,3-dihexylimidazolidine has a molecular weight of 258.42 g/mol, XLogP of 4.02, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-1,3-dihexylimidazolidine is sourced from PubChem (CID 69129645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).