C25H23N — CID 69129788
7-(1H-inden-1-ylmethyl)-1,2,3,6-tetramethylcyclopenta[b]indole (PubChem CID 69129788) has the molecular formula C25H23N and a molecular weight of 337.47 g/mol. Its IUPAC name is 7-(1H-inden-1-ylmethyl)-1,2,3,6-tetramethylcyclopenta[b]indole.
| Compound Name | 7-(1H-inden-1-ylmethyl)-1,2,3,6-tetramethylcyclopenta[b]indole |
|---|---|
| PubChem CID | 69129788 |
| Molecular Formula | C25H23N |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 7-(1H-inden-1-ylmethyl)-1,2,3,6-tetramethylcyclopenta[b]indole |
| SMILES | CC1=C(C)C(C)=C2C1=Nc1cc(C)c(CC3C=Cc4ccccc43)cc12 |
| InChI | InChI=1S/C25H23N/c1-14-11-23-22(24-16(3)15(2)17(4)25(24)26-23)13-20(14)12-19-10-9-18-7-5-6-8-21(18)19/h5-11,13,19H,12H2,1-4H3 |
| InChIKey | PWYYLUSCLPMVAM-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |