About 1,10-dioxaspiro[4.5]decane-2,9-dione
1,10-dioxaspiro[4.5]decane-2,9-dione (PubChem CID 69129924) has the molecular formula C8H10O4
and a molecular weight of 170.16 g/mol. Its IUPAC name is 1,10-dioxaspiro[4.5]decane-2,9-dione.
Molecular Properties
| Compound Name | 1,10-dioxaspiro[4.5]decane-2,9-dione |
| PubChem CID | 69129924 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 1,10-dioxaspiro[4.5]decane-2,9-dione |
| SMILES | O=C1CCCC2(CCC(=O)O2)O1 |
| InChI | InChI=1S/C8H10O4/c9-6-2-1-4-8(11-6)5-3-7(10)12-8/h1-5H2 |
| InChIKey | XFXQDGOPZFTESB-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,10-dioxaspiro[4.5]decane-2,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,10-dioxaspiro[4.5]decane-2,9-dione?
The IUPAC name of 1,10-dioxaspiro[4.5]decane-2,9-dione (CID 69129924) is 1,10-dioxaspiro[4.5]decane-2,9-dione.
What is the SMILES notation for 1,10-dioxaspiro[4.5]decane-2,9-dione?
The canonical SMILES for 1,10-dioxaspiro[4.5]decane-2,9-dione is O=C1CCCC2(CCC(=O)O2)O1.
What is the InChIKey of 1,10-dioxaspiro[4.5]decane-2,9-dione?
The InChIKey is XFXQDGOPZFTESB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O4/c9-6-2-1-4-8(11-6)5-3-7(10)12-8/h1-5H2.
What are the key properties of 1,10-dioxaspiro[4.5]decane-2,9-dione?
1,10-dioxaspiro[4.5]decane-2,9-dione has a molecular weight of 170.16 g/mol, XLogP of 0.75, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,10-dioxaspiro[4.5]decane-2,9-dione is sourced from PubChem (CID 69129924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).