About 2-(3-bromo-2,6-dichlorophenyl)ethanol
2-(3-bromo-2,6-dichlorophenyl)ethanol (PubChem CID 69130097) has the molecular formula C8H7BrCl2O
and a molecular weight of 269.95 g/mol. Its IUPAC name is 2-(3-bromo-2,6-dichlorophenyl)ethanol.
Molecular Properties
| Compound Name | 2-(3-bromo-2,6-dichlorophenyl)ethanol |
| PubChem CID | 69130097 |
| Molecular Formula | C8H7BrCl2O |
| Molecular Weight | 269.95 g/mol |
| Exact Mass | 267.91 |
| IUPAC Name | 2-(3-bromo-2,6-dichlorophenyl)ethanol |
| SMILES | OCCc1c(Cl)ccc(Br)c1Cl |
| InChI | InChI=1S/C8H7BrCl2O/c9-6-1-2-7(10)5(3-4-12)8(6)11/h1-2,12H,3-4H2 |
| InChIKey | MLCIPWBYVROPNE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.95 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-bromo-2,6-dichlorophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromo-2,6-dichlorophenyl)ethanol?
The IUPAC name of 2-(3-bromo-2,6-dichlorophenyl)ethanol (CID 69130097) is 2-(3-bromo-2,6-dichlorophenyl)ethanol.
What is the SMILES notation for 2-(3-bromo-2,6-dichlorophenyl)ethanol?
The canonical SMILES for 2-(3-bromo-2,6-dichlorophenyl)ethanol is OCCc1c(Cl)ccc(Br)c1Cl.
What is the InChIKey of 2-(3-bromo-2,6-dichlorophenyl)ethanol?
The InChIKey is MLCIPWBYVROPNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrCl2O/c9-6-1-2-7(10)5(3-4-12)8(6)11/h1-2,12H,3-4H2.
What are the key properties of 2-(3-bromo-2,6-dichlorophenyl)ethanol?
2-(3-bromo-2,6-dichlorophenyl)ethanol has a molecular weight of 269.95 g/mol, XLogP of 3.29, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromo-2,6-dichlorophenyl)ethanol is sourced from PubChem (CID 69130097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).