About (5R)-3,3-dimethyl-4-thia-1-azabicyclo[3.2.0]heptan-7-one
(5R)-3,3-dimethyl-4-thia-1-azabicyclo[3.2.0]heptan-7-one (PubChem CID 69130124) has the molecular formula C7H11NOS
and a molecular weight of 157.24 g/mol. Its IUPAC name is (5R)-3,3-dimethyl-4-thia-1-azabicyclo[3.2.0]heptan-7-one.
Molecular Properties
| Compound Name | (5R)-3,3-dimethyl-4-thia-1-azabicyclo[3.2.0]heptan-7-one |
| PubChem CID | 69130124 |
| Molecular Formula | C7H11NOS |
| Molecular Weight | 157.24 g/mol |
| Exact Mass | 157.06 |
| IUPAC Name | (5R)-3,3-dimethyl-4-thia-1-azabicyclo[3.2.0]heptan-7-one |
| SMILES | CC1(C)CN2C(=O)C[C@H]2S1 |
| InChI | InChI=1S/C7H11NOS/c1-7(2)4-8-5(9)3-6(8)10-7/h6H,3-4H2,1-2H3/t6-/m1/s1 |
| InChIKey | QKMOGJIBUBHJRI-ZCFIWIBFSA-N |
| XLogP | 1.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.24 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R)-3,3-dimethyl-4-thia-1-azabicyclo[3.2.0]heptan-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-3,3-dimethyl-4-thia-1-azabicyclo[3.2.0]heptan-7-one?
The IUPAC name of (5R)-3,3-dimethyl-4-thia-1-azabicyclo[3.2.0]heptan-7-one (CID 69130124) is (5R)-3,3-dimethyl-4-thia-1-azabicyclo[3.2.0]heptan-7-one.
What is the SMILES notation for (5R)-3,3-dimethyl-4-thia-1-azabicyclo[3.2.0]heptan-7-one?
The canonical SMILES for (5R)-3,3-dimethyl-4-thia-1-azabicyclo[3.2.0]heptan-7-one is CC1(C)CN2C(=O)C[C@H]2S1.
What is the InChIKey of (5R)-3,3-dimethyl-4-thia-1-azabicyclo[3.2.0]heptan-7-one?
The InChIKey is QKMOGJIBUBHJRI-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H11NOS/c1-7(2)4-8-5(9)3-6(8)10-7/h6H,3-4H2,1-2H3/t6-/m1/s1.
What are the key properties of (5R)-3,3-dimethyl-4-thia-1-azabicyclo[3.2.0]heptan-7-one?
(5R)-3,3-dimethyl-4-thia-1-azabicyclo[3.2.0]heptan-7-one has a molecular weight of 157.24 g/mol, XLogP of 1.07, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-3,3-dimethyl-4-thia-1-azabicyclo[3.2.0]heptan-7-one is sourced from PubChem (CID 69130124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).