C28H50N2 — CID 6913048
(2Z)-N-[[4-[[[(2Z)-3,7-dimethylocta-2,6-dienyl]amino]methyl]cyclohexyl]methyl]-3,7-dimethylocta-2,6-dien-1-amine (PubChem CID 6913048) has the molecular formula C28H50N2 and a molecular weight of 414.72 g/mol. Its IUPAC name is (2Z)-N-[[4-[[[(2Z)-3,7-dimethylocta-2,6-dienyl]amino]methyl]cyclohexyl]methyl]-3,7-dimethylocta-2,6-dien-1-amine.
| Compound Name | (2Z)-N-[[4-[[[(2Z)-3,7-dimethylocta-2,6-dienyl]amino]methyl]cyclohexyl]methyl]-3,7-dimethylocta-2,6-dien-1-amine |
|---|---|
| PubChem CID | 6913048 |
| Molecular Formula | C28H50N2 |
| Molecular Weight | 414.72 g/mol |
| Exact Mass | 414.40 |
| IUPAC Name | (2Z)-N-[[4-[[[(2Z)-3,7-dimethylocta-2,6-dienyl]amino]methyl]cyclohexyl]methyl]-3,7-dimethylocta-2,6-dien-1-amine |
| SMILES | CC(C)=CCC/C(C)=C\CNCC1CCC(CNC/C=C(/C)CCC=C(C)C)CC1 |
| InChI | InChI=1S/C28H50N2/c1-23(2)9-7-11-25(5)17-19-29-21-27-13-15-28(16-14-27)22-30-20-18-26(6)12-8-10-24(3)4/h9-10,17-18,27-30H,7-8,11-16,19-22H2,1-6H3/b25-17-,26-18- |
| InChIKey | YZXSUPFBSFKOML-MFYXSQMNSA-N |
| XLogP | 7.36 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.72 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|